Products 162549-39-5

CAS 162549-39-5 is the registry number for 3-(2,4-Difluorophenyl)propanoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2,4-difluorophenyl)propanoyl chloride (CAS 162549-39-5) is a chemical compound with the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. IUPAC name: 3-(2,4-difluorophenyl)propanoyl chloride. InChIKey: HRZVMXQBSBTNFK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClF2O
Molecular weight204.60 g/mol
IUPAC name3-(2,4-difluorophenyl)propanoyl chloride
InChIKeyHRZVMXQBSBTNFK-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)F)CCC(=O)Cl

Computed by PubChem (NCBI)