CAS 1305324-49-5 appears in our catalog under these names: 1-(3-Chloro-2,6-difluorophenyl)propan-2-one, 95%, 1-(3-Chloro-2,6-difluorophenyl)propan-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(3-chloro-2,6-difluorophenyl)propan-2-one (CAS 1305324-49-5) is a chemical compound with the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. IUPAC name: 1-(3-chloro-2,6-difluorophenyl)propan-2-one. InChIKey: SCJBGDYLKQCGIX-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O |
|---|---|
| Molecular weight | 204.60 g/mol |
| IUPAC name | 1-(3-chloro-2,6-difluorophenyl)propan-2-one |
| InChIKey | SCJBGDYLKQCGIX-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=C(C=CC(=C1F)Cl)F |
Computed by PubChem (NCBI)