Products 161712-76-1

CAS 161712-76-1 is the registry number for 3-(3,4-Difluorophenyl)propanoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3,4-difluorophenyl)propanoyl chloride (CAS 161712-76-1) is a chemical compound with the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. IUPAC name: 3-(3,4-difluorophenyl)propanoyl chloride. InChIKey: DDDFLVOQZPSQPV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClF2O
Molecular weight204.60 g/mol
IUPAC name3-(3,4-difluorophenyl)propanoyl chloride
InChIKeyDDDFLVOQZPSQPV-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CCC(=O)Cl)F)F

Computed by PubChem (NCBI)