Products 1215969-79-1
CAS 1215969-79-1 is the registry number for 3-Chloro-1-(3,4-difluorophenyl)-1-propanone. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
3-chloro-1-(3,4-difluorophenyl)propan-1-one (CAS 1215969-79-1) is a chemical compound with the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. IUPAC name: 3-chloro-1-(3,4-difluorophenyl)propan-1-one. InChIKey: FTSSDMQGEYYVPV-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O |
|---|---|
| Molecular weight | 204.60 g/mol |
| IUPAC name | 3-chloro-1-(3,4-difluorophenyl)propan-1-one |
| InChIKey | FTSSDMQGEYYVPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CCCl)F)F |
Computed by PubChem (NCBI)