CAS 138457-39-3 is the registry number for 2-Chloro-1-(2,4-difluorophenyl)propan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-1-(2,4-difluorophenyl)propan-1-one (CAS 138457-39-3) is a chemical compound with the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. IUPAC name: 2-chloro-1-(2,4-difluorophenyl)propan-1-one. InChIKey: QDXQWKIKBKUTRB-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O |
|---|---|
| Molecular weight | 204.60 g/mol |
| IUPAC name | 2-chloro-1-(2,4-difluorophenyl)propan-1-one |
| InChIKey | QDXQWKIKBKUTRB-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=C(C=C(C=C1)F)F)Cl |
Computed by PubChem (NCBI)