CAS 103698-10-8 appears in our catalog under these names: Methyl 3-nitroisonicotinate, 97%, Methyl 3-Nitroisonicotinate, >95% (HPLC), Methyl 3-nitroisonicotinate, Methyl 3-nitroisonicotinate, 97%, 97%. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 500mg, 1g, 5g.
Methyl 3-nitropyridine-4-carboxylate (CAS 103698-10-8) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: methyl 3-nitropyridine-4-carboxylate. InChIKey: VFZBLITUPLITGH-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | methyl 3-nitropyridine-4-carboxylate |
| InChIKey | VFZBLITUPLITGH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=NC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)