CAS 103788-60-9 appears in our catalog under these names: 5-(4-Hydroxybenzylidene)thiazolidine-2,4-dione, 95+%, (5E)-5-(4-Hydroxybenzylidene)-1,3-thiazolidine-2,4-dione, 5-(4-Hydroxybenzylidene)thiazolidine-2,4-dione, 97%. Offered by: Chemat Brand, TRC, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 2,5g.
5-[(4-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (CAS 103788-60-9) is a chemical compound with the molecular formula C10H7NO3S and a molecular weight of 221.23 g/mol. IUPAC name: 5-[(4-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: ARHIHDVVUHVQCP-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3S |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 5-[(4-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | ARHIHDVVUHVQCP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=C2C(=O)NC(=O)S2)O |
Computed by PubChem (NCBI)