Products 56304-45-1

CAS 56304-45-1 is the registry number for 2-Oxo-6-(thiophen-2-yl)-1,2-dihydropyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-oxo-6-thiophen-2-yl-1H-pyridine-3-carboxylic acid (CAS 56304-45-1) is a chemical compound with the molecular formula C10H7NO3S and a molecular weight of 221.23 g/mol. IUPAC name: 2-oxo-6-thiophen-2-yl-1H-pyridine-3-carboxylic acid. InChIKey: QEMPNEIECJTFED-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7NO3S
Molecular weight221.23 g/mol
IUPAC name2-oxo-6-thiophen-2-yl-1H-pyridine-3-carboxylic acid
InChIKeyQEMPNEIECJTFED-UHFFFAOYSA-N
SMILESC1=CSC(=C1)C2=CC=C(C(=O)N2)C(=O)O

Computed by PubChem (NCBI)