CAS 184840-72-0 is the registry number for (5E)-5-(3-Hydroxybenzylidene)-1,3-thiazolidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(5E)-5-[(3-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (CAS 184840-72-0) is a chemical compound with the molecular formula C10H7NO3S and a molecular weight of 221.23 g/mol. IUPAC name: (5E)-5-[(3-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: IKLKVFXCODJJRX-VMPITWQZSA-N.
| Molecular formula | C10H7NO3S |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | (5E)-5-[(3-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | IKLKVFXCODJJRX-VMPITWQZSA-N |
| SMILES | C1=CC(=CC(=C1)O)/C=C/2\C(=O)NC(=O)S2 |
Computed by PubChem (NCBI)