CAS 1502468-19-0 is the registry number for 4-(3-Oxo-2,3-dihydro-1,2-thiazol-5-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(3-oxo-1,2-thiazol-5-yl)benzoic acid (CAS 1502468-19-0) is a chemical compound with the molecular formula C10H7NO3S and a molecular weight of 221.23 g/mol. IUPAC name: 4-(3-oxo-1,2-thiazol-5-yl)benzoic acid. InChIKey: APICOYKTGXZQLM-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3S |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 4-(3-oxo-1,2-thiazol-5-yl)benzoic acid |
| InChIKey | APICOYKTGXZQLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)NS2)C(=O)O |
Computed by PubChem (NCBI)