CAS 1261987-89-6 appears in our catalog under these names: 2-Hydroxy-5-(thiophen-2-yl)pyridine-3-carboxylic acid, 2-Hydroxy-5-(thiophen-2-yl)nicotinic acid 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
2-oxo-5-thiophen-2-yl-1H-pyridine-3-carboxylic acid (CAS 1261987-89-6) is a chemical compound with the molecular formula C10H7NO3S and a molecular weight of 221.23 g/mol. IUPAC name: 2-oxo-5-thiophen-2-yl-1H-pyridine-3-carboxylic acid. InChIKey: VNSFAGWZORAYSM-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3S |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 2-oxo-5-thiophen-2-yl-1H-pyridine-3-carboxylic acid |
| InChIKey | VNSFAGWZORAYSM-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CNC(=O)C(=C2)C(=O)O |
Computed by PubChem (NCBI)