Products 113334-58-0

CAS 113334-58-0 is the registry number for 2-(3-Hydroxyphenyl)thiazole-4-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(3-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid (CAS 113334-58-0) is a chemical compound with the molecular formula C10H7NO3S and a molecular weight of 221.23 g/mol. IUPAC name: 2-(3-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: PJBROFATYWROMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7NO3S
Molecular weight221.23 g/mol
IUPAC name2-(3-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid
InChIKeyPJBROFATYWROMQ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)O)C2=NC(=CS2)C(=O)O

Computed by PubChem (NCBI)