CAS 56355-20-5 appears in our catalog under these names: 4-(Thiazol-2-yloxy)benzoic acid, 96%, 4-(Thiazol-2-yloxy)benzoic acid, 95+%, 4–(thiazol–2–yloxy)benzoicacid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 10g, 5g, 1g, 250mg.
4-(1,3-thiazol-2-yloxy)benzoic acid (CAS 56355-20-5) is a chemical compound with the molecular formula C10H7NO3S and a molecular weight of 221.23 g/mol. IUPAC name: 4-(1,3-thiazol-2-yloxy)benzoic acid. InChIKey: KITFLUYWYOYCSF-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3S |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 4-(1,3-thiazol-2-yloxy)benzoic acid |
| InChIKey | KITFLUYWYOYCSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=NC=CS2 |
Computed by PubChem (NCBI)