Products 925004-40-6
CAS 925004-40-6 appears in our catalog under these names: 2-Hydroxy-6-thiophen-2-yl-isonicotinic Acid, 2-Hydroxy-6-(thiophen-2-yl)isonicotinic acid. Offered by: TRC, Fluorochem. Available pack sizes: 250mg, 1g.
2-oxo-6-thiophen-2-yl-1H-pyridine-4-carboxylic acid (CAS 925004-40-6) is a chemical compound with the molecular formula C10H7NO3S and a molecular weight of 221.23 g/mol. IUPAC name: 2-oxo-6-thiophen-2-yl-1H-pyridine-4-carboxylic acid. InChIKey: ORFATQHUKCOAOV-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3S |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 2-oxo-6-thiophen-2-yl-1H-pyridine-4-carboxylic acid |
| InChIKey | ORFATQHUKCOAOV-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=CC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)