CAS 36705-82-5 appears in our catalog under these names: 2-(4-Hydroxyphenyl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(4-Hydroxyphenyl)-1,3-thiazole-4-carboxylic acid, 2-(4-Hydroxyphenyl)-1,3-thiazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 250mg, 0,5g, 50mg, 100mg, 500mg.
2-(4-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid (CAS 36705-82-5) is a chemical compound with the molecular formula C10H7NO3S and a molecular weight of 221.23 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: YSKMZPAUCUGNFT-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3S |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | YSKMZPAUCUGNFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C(=O)O)O |
Computed by PubChem (NCBI)