Products 60175-04-4

CAS 60175-04-4 is the registry number for Gabapentin Ethyl Ester Hydrochloride. Offered by: TRC, Mikromol. Available pack sizes: 2,5g, 250mg, 25mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[1-(aminomethyl)cyclohexyl]acetate;hydrochloride (CAS 60175-04-4) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: ethyl 2-[1-(aminomethyl)cyclohexyl]acetate;hydrochloride. InChIKey: UHYCAUUDSWTCMI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22ClNO2
Molecular weight235.75 g/mol
IUPAC nameethyl 2-[1-(aminomethyl)cyclohexyl]acetate;hydrochloride
InChIKeyUHYCAUUDSWTCMI-UHFFFAOYSA-N
SMILESCCOC(=O)CC1(CCCCC1)CN.Cl

Computed by PubChem (NCBI)