Products 2227765-76-4
CAS 2227765-76-4 is the registry number for tert-Butyl (1R,3S)-3-aminocyclohexane-1-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-tert-butyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride (CAS 2227765-76-4) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: cis-tert-butyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: WXQUHQMFMVLZAV-RJUBDTSPSA-N.
| Molecular formula | C11H22ClNO2 |
|---|---|
| Molecular weight | 235.75 g/mol |
| IUPAC name | cis-tert-butyl (1R,3S)-3-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | WXQUHQMFMVLZAV-RJUBDTSPSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)