Products 1048922-51-5
CAS 1048922-51-5 appears in our catalog under these names: 3-(4-Chlorophenyl)-1,2-oxazole-4-carboxylic acid, 95%, 3-(4-Chlorophenyl)isoxazole-4-carboxylic acid, 97%, 3-(4-Chloro-phenyl)-isoxazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
3-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid (CAS 1048922-51-5) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: MKYNJVCSVZKIHU-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | MKYNJVCSVZKIHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC=C2C(=O)O)Cl |
Computed by PubChem (NCBI)