CAS 1049922-12-4 appears in our catalog under these names: 3-Bromo-4-((5-methyl-1,2-oxazol-3-yl)methoxy)benzoic acid, 95%, 3-Bromo-4-((5-methyl-1,2-oxazol-3-yl)methoxy)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-bromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]benzoic acid (CAS 1049922-12-4) is a chemical compound with the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. IUPAC name: 3-bromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]benzoic acid. InChIKey: WFHYDBKDQQSNIQ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO4 |
|---|---|
| Molecular weight | 312.12 g/mol |
| IUPAC name | 3-bromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]benzoic acid |
| InChIKey | WFHYDBKDQQSNIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)COC2=C(C=C(C=C2)C(=O)O)Br |
Computed by PubChem (NCBI)