CAS 2222512-17-4 is the registry number for 1,3-Dimethyl 2-(5-bromo-2-cyanophenyl)propanedioate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Dimethyl 2-(5-bromo-2-cyanophenyl)propanedioate (CAS 2222512-17-4) is a chemical compound with the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. IUPAC name: dimethyl 2-(5-bromo-2-cyanophenyl)propanedioate. InChIKey: XXODSEMMNUNCQL-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO4 |
|---|---|
| Molecular weight | 312.12 g/mol |
| IUPAC name | dimethyl 2-(5-bromo-2-cyanophenyl)propanedioate |
| InChIKey | XXODSEMMNUNCQL-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=CC(=C1)Br)C#N)C(=O)OC |
Computed by PubChem (NCBI)