Products 1370418-87-3

CAS 1370418-87-3 is the registry number for 3-(5-Bromo-2-methoxyphenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(5-bromo-2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1370418-87-3) is a chemical compound with the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. IUPAC name: 3-(5-bromo-2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: WRAWYDBYDMGDKG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BrNO4
Molecular weight312.12 g/mol
IUPAC name3-(5-bromo-2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid
InChIKeyWRAWYDBYDMGDKG-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=C(C=CC(=C2)Br)OC)C(=O)O

Computed by PubChem (NCBI)