CAS 95196-95-5 appears in our catalog under these names: Methyl 2-bromo-3-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)propanoate, 95%, Methyl 2-bromo-3-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)propanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-bromo-3-(1,3-dioxoisoindol-2-yl)propanoate (CAS 95196-95-5) is a chemical compound with the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. IUPAC name: methyl 2-bromo-3-(1,3-dioxoisoindol-2-yl)propanoate. InChIKey: SRIHQCPYXNQAMD-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO4 |
|---|---|
| Molecular weight | 312.12 g/mol |
| IUPAC name | methyl 2-bromo-3-(1,3-dioxoisoindol-2-yl)propanoate |
| InChIKey | SRIHQCPYXNQAMD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CN1C(=O)C2=CC=CC=C2C1=O)Br |
Computed by PubChem (NCBI)