Products 2203195-04-2

CAS 2203195-04-2 is the registry number for 4-Bromo-2-methyl-benzoic acid 2,5-dioxo-pyrrolidin-1-yl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g, 10g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 4-bromo-2-methylbenzoate (CAS 2203195-04-2) is a chemical compound with the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-bromo-2-methylbenzoate. InChIKey: GFOJHCWIODYIHS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BrNO4
Molecular weight312.12 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 4-bromo-2-methylbenzoate
InChIKeyGFOJHCWIODYIHS-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)Br)C(=O)ON2C(=O)CCC2=O

Computed by PubChem (NCBI)