CAS 745078-99-3 is the registry number for Methyl 5-(3-bromo-4-methoxyphenyl)isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-(3-bromo-4-methoxyphenyl)-1,2-oxazole-3-carboxylate (CAS 745078-99-3) is a chemical compound with the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. IUPAC name: methyl 5-(3-bromo-4-methoxyphenyl)-1,2-oxazole-3-carboxylate. InChIKey: AOBZRUVLOOQWQD-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO4 |
|---|---|
| Molecular weight | 312.12 g/mol |
| IUPAC name | methyl 5-(3-bromo-4-methoxyphenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | AOBZRUVLOOQWQD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=NO2)C(=O)OC)Br |
Computed by PubChem (NCBI)