CAS 41234-19-9 is the registry number for 3-(2-Bromo-4,5-dimethoxyphenyl)-2-cyanoacrylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyanoprop-2-enoic acid (CAS 41234-19-9) is a chemical compound with the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. IUPAC name: (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyanoprop-2-enoic acid. InChIKey: ZBOUKSASKUHFEE-FPYGCLRLSA-N.
| Molecular formula | C12H10BrNO4 |
|---|---|
| Molecular weight | 312.12 g/mol |
| IUPAC name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyanoprop-2-enoic acid |
| InChIKey | ZBOUKSASKUHFEE-FPYGCLRLSA-N |
| SMILES | COC1=C(C=C(C(=C1)/C=C(\C#N)/C(=O)O)Br)OC |
Computed by PubChem (NCBI)