CAS 1221724-03-3 appears in our catalog under these names: 3-Bromo-4-((3-methyl-1,2-oxazol-5-yl)methoxy)benzoic acid, 3-Bromo-4-((3-methyl-1,2-oxazol-5-yl)methoxy)benzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
3-bromo-4-[(3-methyl-1,2-oxazol-5-yl)methoxy]benzoic acid (CAS 1221724-03-3) is a chemical compound with the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. IUPAC name: 3-bromo-4-[(3-methyl-1,2-oxazol-5-yl)methoxy]benzoic acid. InChIKey: WFJRSMVFXHOEJP-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO4 |
|---|---|
| Molecular weight | 312.12 g/mol |
| IUPAC name | 3-bromo-4-[(3-methyl-1,2-oxazol-5-yl)methoxy]benzoic acid |
| InChIKey | WFJRSMVFXHOEJP-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)COC2=C(C=C(C=C2)C(=O)O)Br |
Computed by PubChem (NCBI)