CAS 2203194-99-2 is the registry number for 5-Bromo-2-methyl-benzoic acid 2,5-dioxo-pyrrolidin-1-yl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,5-dioxopyrrolidin-1-yl) 5-bromo-2-methylbenzoate (CAS 2203194-99-2) is a chemical compound with the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 5-bromo-2-methylbenzoate. InChIKey: JCRUPHUAPVCAFP-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO4 |
|---|---|
| Molecular weight | 312.12 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 5-bromo-2-methylbenzoate |
| InChIKey | JCRUPHUAPVCAFP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)C(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)