Products 1050884-12-2

CAS 1050884-12-2 is the registry number for 7-(5-Methylthiophen-2-yl)-4,7-dioxoheptanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

7-(5-methylthiophen-2-yl)-4,7-dioxoheptanoic acid (CAS 1050884-12-2) is a chemical compound with the molecular formula C12H14O4S and a molecular weight of 254.30 g/mol. IUPAC name: 7-(5-methylthiophen-2-yl)-4,7-dioxoheptanoic acid. InChIKey: XGNDWMHRNFGALI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O4S
Molecular weight254.30 g/mol
IUPAC name7-(5-methylthiophen-2-yl)-4,7-dioxoheptanoic acid
InChIKeyXGNDWMHRNFGALI-UHFFFAOYSA-N
SMILESCC1=CC=C(S1)C(=O)CCC(=O)CCC(=O)O

Computed by PubChem (NCBI)