Products 327618-07-5

CAS 327618-07-5 is the registry number for Benzyl tetrahydrothiophene-2-carboxylate 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Benzyl 1,1-dioxothiolane-2-carboxylate (CAS 327618-07-5) is a chemical compound with the molecular formula C12H14O4S and a molecular weight of 254.30 g/mol. IUPAC name: benzyl 1,1-dioxothiolane-2-carboxylate. InChIKey: MZLBGOQATXEFDO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O4S
Molecular weight254.30 g/mol
IUPAC namebenzyl 1,1-dioxothiolane-2-carboxylate
InChIKeyMZLBGOQATXEFDO-UHFFFAOYSA-N
SMILESC1CC(S(=O)(=O)C1)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)