CAS 327618-07-5 is the registry number for Benzyl tetrahydrothiophene-2-carboxylate 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 1,1-dioxothiolane-2-carboxylate (CAS 327618-07-5) is a chemical compound with the molecular formula C12H14O4S and a molecular weight of 254.30 g/mol. IUPAC name: benzyl 1,1-dioxothiolane-2-carboxylate. InChIKey: MZLBGOQATXEFDO-UHFFFAOYSA-N.
| Molecular formula | C12H14O4S |
|---|---|
| Molecular weight | 254.30 g/mol |
| IUPAC name | benzyl 1,1-dioxothiolane-2-carboxylate |
| InChIKey | MZLBGOQATXEFDO-UHFFFAOYSA-N |
| SMILES | C1CC(S(=O)(=O)C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)