Products 1098376-16-9

CAS 1098376-16-9 is the registry number for 4-((2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)thio)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)butanoic acid (CAS 1098376-16-9) is a chemical compound with the molecular formula C12H14O4S and a molecular weight of 254.30 g/mol. IUPAC name: 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)butanoic acid. InChIKey: XDORWVPUERYEEL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O4S
Molecular weight254.30 g/mol
IUPAC name4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)butanoic acid
InChIKeyXDORWVPUERYEEL-UHFFFAOYSA-N
SMILESC1COC2=C(O1)C=CC(=C2)SCCCC(=O)O

Computed by PubChem (NCBI)