CAS 137473-27-9 appears in our catalog under these names: Ethyl 4–methanesulfonylcinnamate, Ethyl 4-methanesulfonylcinnamate 98% (E). Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Ethyl (E)-3-(4-methylsulfonylphenyl)prop-2-enoate (CAS 137473-27-9) is a chemical compound with the molecular formula C12H14O4S and a molecular weight of 254.30 g/mol. IUPAC name: ethyl (E)-3-(4-methylsulfonylphenyl)prop-2-enoate. InChIKey: YOUOTKHSWKCRQF-RMKNXTFCSA-N.
| Molecular formula | C12H14O4S |
|---|---|
| Molecular weight | 254.30 g/mol |
| IUPAC name | ethyl (E)-3-(4-methylsulfonylphenyl)prop-2-enoate |
| InChIKey | YOUOTKHSWKCRQF-RMKNXTFCSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC=C(C=C1)S(=O)(=O)C |
Computed by PubChem (NCBI)