Products 1156165-48-8
CAS 1156165-48-8 appears in our catalog under these names: 2-(4-((Cyclopropylmethyl)sulfonyl)phenyl)acetic acid, 95-<97%, 2-(4-((Cyclopropylmethyl)sulfonyl)phenyl)acetic acid, 98%, 2-(4-Cyclopropylmethanesulfonylphenyl)acetic acid, 2-(4-CYCLOPROPYLMETHANESULFONYLPHENYL)ACETIC ACID, 97%, 97%, 2-(4-Cyclopropylmethanesulfonylphenyl)acetic acid, 97%. Offered by: Hoffman Fine Chemicals, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2,5g, 5g, 0,5g, 50mg.
2-[4-(cyclopropylmethylsulfonyl)phenyl]acetic acid (CAS 1156165-48-8) is a chemical compound with the molecular formula C12H14O4S and a molecular weight of 254.30 g/mol. IUPAC name: 2-[4-(cyclopropylmethylsulfonyl)phenyl]acetic acid. InChIKey: HJHIWZSHVWABCJ-UHFFFAOYSA-N.
| Molecular formula | C12H14O4S |
|---|---|
| Molecular weight | 254.30 g/mol |
| IUPAC name | 2-[4-(cyclopropylmethylsulfonyl)phenyl]acetic acid |
| InChIKey | HJHIWZSHVWABCJ-UHFFFAOYSA-N |
| SMILES | C1CC1CS(=O)(=O)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)