CAS 2412840-80-1 is the registry number for Benzyl 2-(cyclopropanesulfonyl)acetate, 90%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Benzyl 2-cyclopropylsulfonylacetate (CAS 2412840-80-1) is a chemical compound with the molecular formula C12H14O4S and a molecular weight of 254.30 g/mol. IUPAC name: benzyl 2-cyclopropylsulfonylacetate. InChIKey: YBNQAQJSLXDOFZ-UHFFFAOYSA-N.
| Molecular formula | C12H14O4S |
|---|---|
| Molecular weight | 254.30 g/mol |
| IUPAC name | benzyl 2-cyclopropylsulfonylacetate |
| InChIKey | YBNQAQJSLXDOFZ-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)CC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)