CAS 117659-25-3 is the registry number for (E)-Ethyl 3-tosylacrylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
Ethyl (E)-3-(4-methylphenyl)sulfonylprop-2-enoate (CAS 117659-25-3) is a chemical compound with the molecular formula C12H14O4S and a molecular weight of 254.30 g/mol. IUPAC name: ethyl (E)-3-(4-methylphenyl)sulfonylprop-2-enoate. InChIKey: IVQHTVXRSHDTBE-CMDGGOBGSA-N.
| Molecular formula | C12H14O4S |
|---|---|
| Molecular weight | 254.30 g/mol |
| IUPAC name | ethyl (E)-3-(4-methylphenyl)sulfonylprop-2-enoate |
| InChIKey | IVQHTVXRSHDTBE-CMDGGOBGSA-N |
| SMILES | CCOC(=O)/C=C/S(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)