Products 926215-51-2
CAS 926215-51-2 appears in our catalog under these names: 3-(2,3-Dihydro-1h-inden-5-ylsulfonyl)propanoic acid, 95%, 3-(2,3-Dihydro-1H-indene-5-sulfonyl)propanoic acid, 95%, 3-(2,3-Dihydro-1H-indene-5-sulfonyl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-(2,3-dihydro-1H-inden-5-ylsulfonyl)propanoic acid (CAS 926215-51-2) is a chemical compound with the molecular formula C12H14O4S and a molecular weight of 254.30 g/mol. IUPAC name: 3-(2,3-dihydro-1H-inden-5-ylsulfonyl)propanoic acid. InChIKey: DJFNDMWAGZHPAU-UHFFFAOYSA-N.
| Molecular formula | C12H14O4S |
|---|---|
| Molecular weight | 254.30 g/mol |
| IUPAC name | 3-(2,3-dihydro-1H-inden-5-ylsulfonyl)propanoic acid |
| InChIKey | DJFNDMWAGZHPAU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)S(=O)(=O)CCC(=O)O |
Computed by PubChem (NCBI)