CAS 873383-88-1 is the registry number for 1,1-Dioxo-4-phenyl-1-thiane-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
1,1-dioxo-4-phenylthiane-4-carboxylic acid (CAS 873383-88-1) is a chemical compound with the molecular formula C12H14O4S and a molecular weight of 254.30 g/mol. IUPAC name: 1,1-dioxo-4-phenylthiane-4-carboxylic acid. InChIKey: DUTQBTWYUYSSJL-UHFFFAOYSA-N.
| Molecular formula | C12H14O4S |
|---|---|
| Molecular weight | 254.30 g/mol |
| IUPAC name | 1,1-dioxo-4-phenylthiane-4-carboxylic acid |
| InChIKey | DUTQBTWYUYSSJL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)