Products 1052404-68-8

CAS 1052404-68-8 is the registry number for 4-(Aminomethyl)-5,5,5-trifluoropentanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

4-(aminomethyl)-5,5,5-trifluoropentanoic acid;hydrochloride (CAS 1052404-68-8) is a chemical compound with the molecular formula C6H11ClF3NO2 and a molecular weight of 221.60 g/mol. IUPAC name: 4-(aminomethyl)-5,5,5-trifluoropentanoic acid;hydrochloride. InChIKey: IUYUKQUTNGOQHL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClF3NO2
Molecular weight221.60 g/mol
IUPAC name4-(aminomethyl)-5,5,5-trifluoropentanoic acid;hydrochloride
InChIKeyIUYUKQUTNGOQHL-UHFFFAOYSA-N
SMILESC(CC(=O)O)C(CN)C(F)(F)F.Cl

Computed by PubChem (NCBI)