Products 1177279-77-4

CAS 1177279-77-4 is the registry number for Ethyl 2-((2,2,2-Trifluoroethyl)amino)acetate Hydrochloride. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-(2,2,2-trifluoroethylamino)acetate;hydrochloride (CAS 1177279-77-4) is a chemical compound with the molecular formula C6H11ClF3NO2 and a molecular weight of 221.60 g/mol. IUPAC name: ethyl 2-(2,2,2-trifluoroethylamino)acetate;hydrochloride. InChIKey: QWNQOKQVSHNBRL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClF3NO2
Molecular weight221.60 g/mol
IUPAC nameethyl 2-(2,2,2-trifluoroethylamino)acetate;hydrochloride
InChIKeyQWNQOKQVSHNBRL-UHFFFAOYSA-N
SMILESCCOC(=O)CNCC(F)(F)F.Cl

Computed by PubChem (NCBI)