Products 146425-31-2

CAS 146425-31-2 is the registry number for Ethyl 3-amino-4,4,4-trifluorobutyrate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Ethyl 3-amino-4,4,4-trifluorobutanoate;hydrochloride (CAS 146425-31-2) is a chemical compound with the molecular formula C6H11ClF3NO2 and a molecular weight of 221.60 g/mol. IUPAC name: ethyl 3-amino-4,4,4-trifluorobutanoate;hydrochloride. InChIKey: MXIOWDVYFZIGCM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClF3NO2
Molecular weight221.60 g/mol
IUPAC nameethyl 3-amino-4,4,4-trifluorobutanoate;hydrochloride
InChIKeyMXIOWDVYFZIGCM-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C(F)(F)F)N.Cl

Computed by PubChem (NCBI)