Products 1803565-62-9
CAS 1803565-62-9 appears in our catalog under these names: 5-Amino-3-(trifluoromethyl)pentanoic acid hydrochloride, 95-<97%, 5-Amino-3-(trifluoromethyl)pentanoic acid hydrochloride, 95%, 5-Amino-3-(trifluoromethyl)pentanoic acid hydrochloride. Offered by: Hoffman Fine Chemicals, AmBeed, Biosynth. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g, 0,5g, 50mg.
5-amino-3-(trifluoromethyl)pentanoic acid;hydrochloride (CAS 1803565-62-9) is a chemical compound with the molecular formula C6H11ClF3NO2 and a molecular weight of 221.60 g/mol. IUPAC name: 5-amino-3-(trifluoromethyl)pentanoic acid;hydrochloride. InChIKey: QBGQEXLPPCIBME-UHFFFAOYSA-N.
| Molecular formula | C6H11ClF3NO2 |
|---|---|
| Molecular weight | 221.60 g/mol |
| IUPAC name | 5-amino-3-(trifluoromethyl)pentanoic acid;hydrochloride |
| InChIKey | QBGQEXLPPCIBME-UHFFFAOYSA-N |
| SMILES | C(CN)C(CC(=O)O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)