Products 3069785-27-6
CAS 3069785-27-6 is the registry number for 2-Amino-6,6,6-trifluorohexanoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-amino-6,6,6-trifluorohexanoic acid;hydrochloride (CAS 3069785-27-6) is a chemical compound with the molecular formula C6H11ClF3NO2 and a molecular weight of 221.60 g/mol. IUPAC name: 2-amino-6,6,6-trifluorohexanoic acid;hydrochloride. InChIKey: DRKZIKWYFVGROA-UHFFFAOYSA-N.
| Molecular formula | C6H11ClF3NO2 |
|---|---|
| Molecular weight | 221.60 g/mol |
| IUPAC name | 2-amino-6,6,6-trifluorohexanoic acid;hydrochloride |
| InChIKey | DRKZIKWYFVGROA-UHFFFAOYSA-N |
| SMILES | C(CC(C(=O)O)N)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)