CAS 2126179-11-9 is the registry number for Ethyl 2-amino-3,3,3-trifluoro-2-methylpropanoate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 2-amino-3,3,3-trifluoro-2-methylpropanoate;hydrochloride (CAS 2126179-11-9) is a chemical compound with the molecular formula C6H11ClF3NO2 and a molecular weight of 221.60 g/mol. IUPAC name: ethyl 2-amino-3,3,3-trifluoro-2-methylpropanoate;hydrochloride. InChIKey: XFFASFDWFZUIPV-UHFFFAOYSA-N.
| Molecular formula | C6H11ClF3NO2 |
|---|---|
| Molecular weight | 221.60 g/mol |
| IUPAC name | ethyl 2-amino-3,3,3-trifluoro-2-methylpropanoate;hydrochloride |
| InChIKey | XFFASFDWFZUIPV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)