Products 1803611-20-2

CAS 1803611-20-2 is the registry number for Methyl 3-((2,2,2-trifluoroethyl)amino)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-(2,2,2-trifluoroethylamino)propanoate;hydrochloride (CAS 1803611-20-2) is a chemical compound with the molecular formula C6H11ClF3NO2 and a molecular weight of 221.60 g/mol. IUPAC name: methyl 3-(2,2,2-trifluoroethylamino)propanoate;hydrochloride. InChIKey: BPKRBQFHWHQPKI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClF3NO2
Molecular weight221.60 g/mol
IUPAC namemethyl 3-(2,2,2-trifluoroethylamino)propanoate;hydrochloride
InChIKeyBPKRBQFHWHQPKI-UHFFFAOYSA-N
SMILESCOC(=O)CCNCC(F)(F)F.Cl

Computed by PubChem (NCBI)