CAS 1212216-61-9 is the registry number for (S)-Ethyl 3-amino-4,4,4-trifluorobutanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl (3S)-3-amino-4,4,4-trifluorobutanoate;hydrochloride (CAS 1212216-61-9) is a chemical compound with the molecular formula C6H11ClF3NO2 and a molecular weight of 221.60 g/mol. IUPAC name: ethyl (3S)-3-amino-4,4,4-trifluorobutanoate;hydrochloride. InChIKey: MXIOWDVYFZIGCM-WCCKRBBISA-N.
| Molecular formula | C6H11ClF3NO2 |
|---|---|
| Molecular weight | 221.60 g/mol |
| IUPAC name | ethyl (3S)-3-amino-4,4,4-trifluorobutanoate;hydrochloride |
| InChIKey | MXIOWDVYFZIGCM-WCCKRBBISA-N |
| SMILES | CCOC(=O)C[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)