CAS 1262390-41-9 appears in our catalog under these names: (S)-2-Amino-6,6,6-trifluorohexanoic acid hydrochloride, 98%, (S)–2–Amino–6,6,6–trifluorohexanoic acid hydrochloride. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g.
(2R)-2-amino-6,6,6-trifluorohexanoic acid;hydrochloride (CAS 1262390-41-9) is a chemical compound with the molecular formula C6H11ClF3NO2 and a molecular weight of 221.60 g/mol. IUPAC name: (2R)-2-amino-6,6,6-trifluorohexanoic acid;hydrochloride. InChIKey: DRKZIKWYFVGROA-PGMHMLKASA-N.
| Molecular formula | C6H11ClF3NO2 |
|---|---|
| Molecular weight | 221.60 g/mol |
| IUPAC name | (2R)-2-amino-6,6,6-trifluorohexanoic acid;hydrochloride |
| InChIKey | DRKZIKWYFVGROA-PGMHMLKASA-N |
| SMILES | C(C[C@H](C(=O)O)N)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)