CAS 342636-66-2 appears in our catalog under these names: (4-Fluoro-3,5-dimethylphenyl)boronic acid 98%, (4-fluoro-3,5-dimethylphenyl)boronic acid, 98%, 98%, 3,5-Dimethyl-4-fluorophenylboronic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
(4-fluoro-3,5-dimethylphenyl)boronic acid (CAS 342636-66-2) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (4-fluoro-3,5-dimethylphenyl)boronic acid. InChIKey: PQIOZTCJOZUCMI-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO2 |
|---|---|
| Molecular weight | 167.98 g/mol |
| IUPAC name | (4-fluoro-3,5-dimethylphenyl)boronic acid |
| InChIKey | PQIOZTCJOZUCMI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)F)C)(O)O |
Computed by PubChem (NCBI)