Products 1392512-54-7

CAS 1392512-54-7 appears in our catalog under these names: 2,6-Dimethyl-4-fluorophenylboronic acid, 95%, 2,6-Dimethyl-4-fluorophenylboronic acid, (4-Fluoro-2,6-dimethylphenyl)boronic acid 97%, 2,6-Dimethyl-4-fluorophenylboronic acid, 97%, 97%, 2,6-DIMETHYL-4-FLUOROPHENYLBORONIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

(4-fluoro-2,6-dimethylphenyl)boronic acid (CAS 1392512-54-7) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (4-fluoro-2,6-dimethylphenyl)boronic acid. InChIKey: GNTWJIXJCKRFJD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10BFO2
Molecular weight167.98 g/mol
IUPAC name(4-fluoro-2,6-dimethylphenyl)boronic acid
InChIKeyGNTWJIXJCKRFJD-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1C)F)C)(O)O

Computed by PubChem (NCBI)