Products 1318760-09-6
CAS 1318760-09-6 appears in our catalog under these names: 4-Ethyl-3-fluorophenylboronic acid, 97%, (4-Ethyl-3-fluorophenyl)boronic acid 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
(4-ethyl-3-fluorophenyl)boronic acid (CAS 1318760-09-6) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (4-ethyl-3-fluorophenyl)boronic acid. InChIKey: WSKYKIKQGUYJSL-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO2 |
|---|---|
| Molecular weight | 167.98 g/mol |
| IUPAC name | (4-ethyl-3-fluorophenyl)boronic acid |
| InChIKey | WSKYKIKQGUYJSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CC)F)(O)O |
Computed by PubChem (NCBI)