CAS 2950233-32-4 is the registry number for (3-Fluoro-2,6-dimethylphenyl)boronic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(3-fluoro-2,6-dimethylphenyl)boronic acid (CAS 2950233-32-4) is a chemical compound with the molecular formula C8H10BFO2 and a molecular weight of 167.98 g/mol. IUPAC name: (3-fluoro-2,6-dimethylphenyl)boronic acid. InChIKey: HFXSCMDMIHRVDC-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO2 |
|---|---|
| Molecular weight | 167.98 g/mol |
| IUPAC name | (3-fluoro-2,6-dimethylphenyl)boronic acid |
| InChIKey | HFXSCMDMIHRVDC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1C)F)C)(O)O |
Computed by PubChem (NCBI)