CAS 1075719-87-7 appears in our catalog under these names: 2-(4-Ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%, 2-(4-Ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, ≥97-<99%, 4–Ethylphenylboronic acid pinacol ester, 2-(4-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, 2-(4-Ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 200g, 300g, 400g, 500g, 600g, 25g, 5g.
2-(4-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1075719-87-7) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 2-(4-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RWANCHDMVNWYHW-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 2-(4-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RWANCHDMVNWYHW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC |
Computed by PubChem (NCBI)